C12H22N2O3S — CID 113353132
(2R)-3,3-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid (PubChem CID 113353132) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 113353132 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R)-3,3-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)CC1CSCCN1)C(=O)O |
| InChI | InChI=1S/C12H22N2O3S/c1-12(2,3)10(11(16)17)14-9(15)6-8-7-18-5-4-13-8/h8,10,13H,4-7H2,1-3H3,(H,14,15)(H,16,17)/t8?,10-/m0/s1 |
| InChIKey | ZWKLQDNJXZSPON-HTLJXXAVSA-N |
| XLogP | 0.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |