C11H20N2O3S — CID 66420329
3-methyl-3-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid (PubChem CID 66420329) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-methyl-3-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid.
| Compound Name | 3-methyl-3-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 66420329 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-methyl-3-[(2-thiomorpholin-3-ylacetyl)amino]butanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2,6-10(15)16)13-9(14)5-8-7-17-4-3-12-8/h8,12H,3-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | YKILBYWXRLQZEO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |