C12H23ClN2O3S — CID 119938665
ethyl 2-methyl-2-[(2-thiomorpholin-3-ylacetyl)amino]propanoate;hydrochloride (PubChem CID 119938665) has the molecular formula C12H23ClN2O3S and a molecular weight of 310.85 g/mol. Its IUPAC name is ethyl 2-methyl-2-[(2-thiomorpholin-3-ylacetyl)amino]propanoate;hydrochloride.
| Compound Name | ethyl 2-methyl-2-[(2-thiomorpholin-3-ylacetyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119938665 |
| Molecular Formula | C12H23ClN2O3S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl 2-methyl-2-[(2-thiomorpholin-3-ylacetyl)amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)(C)NC(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C12H22N2O3S.ClH/c1-4-17-11(16)12(2,3)14-10(15)7-9-8-18-6-5-13-9;/h9,13H,4-8H2,1-3H3,(H,14,15);1H |
| InChIKey | GEFZXWONIZKOOT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |