C11H21ClN2O3S — CID 119935716
methyl 3-[(2-thiomorpholin-3-ylacetyl)amino]butanoate;hydrochloride (PubChem CID 119935716) has the molecular formula C11H21ClN2O3S and a molecular weight of 296.82 g/mol. Its IUPAC name is methyl 3-[(2-thiomorpholin-3-ylacetyl)amino]butanoate;hydrochloride.
| Compound Name | methyl 3-[(2-thiomorpholin-3-ylacetyl)amino]butanoate;hydrochloride |
|---|---|
| PubChem CID | 119935716 |
| Molecular Formula | C11H21ClN2O3S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | methyl 3-[(2-thiomorpholin-3-ylacetyl)amino]butanoate;hydrochloride |
| SMILES | COC(=O)CC(C)NC(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C11H20N2O3S.ClH/c1-8(5-11(15)16-2)13-10(14)6-9-7-17-4-3-12-9;/h8-9,12H,3-7H2,1-2H3,(H,13,14);1H |
| InChIKey | ANIHTWOQRMKWFX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |