C13H25N3O2S — CID 66420236
N,4-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]pentanamide (PubChem CID 66420236) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is N,4-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]pentanamide.
| Compound Name | N,4-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 66420236 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N,4-dimethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]pentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C13H25N3O2S/c1-9(2)6-11(13(18)14-3)16-12(17)7-10-8-19-5-4-15-10/h9-11,15H,4-8H2,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | KIBJCCGESJFART-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |