C11H12BrClN2O4 — CID 57162274
3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoic acid (PubChem CID 57162274) has the molecular formula C11H12BrClN2O4 and a molecular weight of 351.58 g/mol. Its IUPAC name is 3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoic acid.
| Compound Name | 3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 57162274 |
| Molecular Formula | C11H12BrClN2O4 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoic acid |
| SMILES | NCC(=O)NC(CC(=O)O)c1cc(Br)cc(Cl)c1O |
| InChI | InChI=1S/C11H12BrClN2O4/c12-5-1-6(11(19)7(13)2-5)8(3-10(17)18)15-9(16)4-14/h1-2,8,19H,3-4,14H2,(H,15,16)(H,17,18) |
| InChIKey | MCYSGNDCCWQXFB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|