C15H18N2O3S — CID 171286810
4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,2,3-triol (PubChem CID 171286810) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,2,3-triol.
| Compound Name | 4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 171286810 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc([C@@H](c2cccs2)N2CCNCC2)c(O)c1O |
| InChI | InChI=1S/C15H18N2O3S/c18-11-4-3-10(14(19)15(11)20)13(12-2-1-9-21-12)17-7-5-16-6-8-17/h1-4,9,13,16,18-20H,5-8H2/t13-/m0/s1 |
| InChIKey | NBBHVAWHSPFIIC-ZDUSSCGKSA-N |
| XLogP | 1.86 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|