C15H17FN2OS — CID 171175142
3-fluoro-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol (PubChem CID 171175142) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-fluoro-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol.
| Compound Name | 3-fluoro-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 171175142 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-fluoro-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
| SMILES | Oc1ccc([C@@H](c2cccs2)N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C15H17FN2OS/c16-13-10-11(19)3-4-12(13)15(14-2-1-9-20-14)18-7-5-17-6-8-18/h1-4,9-10,15,17,19H,5-8H2/t15-/m0/s1 |
| InChIKey | OXIOFVVXTUZSMA-HNNXBMFYSA-N |
| XLogP | 2.59 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |