C15H17Cl2FN2S — CID 171179722
1-[(R)-(2-chloro-4-fluorophenyl)-thiophen-2-ylmethyl]piperazine;hydrochloride (PubChem CID 171179722) has the molecular formula C15H17Cl2FN2S and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-[(R)-(2-chloro-4-fluorophenyl)-thiophen-2-ylmethyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-(2-chloro-4-fluorophenyl)-thiophen-2-ylmethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171179722 |
| Molecular Formula | C15H17Cl2FN2S |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-[(R)-(2-chloro-4-fluorophenyl)-thiophen-2-ylmethyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc([C@H](c2cccs2)N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H16ClFN2S.ClH/c16-13-10-11(17)3-4-12(13)15(14-2-1-9-20-14)19-7-5-18-6-8-19;/h1-4,9-10,15,18H,5-8H2;1H/t15-;/m1./s1 |
| InChIKey | SMKCNUUSMXBPIB-XFULWGLBSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |