C17H19ClF4N2O2 — CID 171176921
1-[(S)-furan-2-yl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171176921) has the molecular formula C17H19ClF4N2O2 and a molecular weight of 394.80 g/mol. Its IUPAC name is 1-[(S)-furan-2-yl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-furan-2-yl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171176921 |
| Molecular Formula | C17H19ClF4N2O2 |
| Molecular Weight | 394.80 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[(S)-furan-2-yl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)C(F)(F)Oc1ccc([C@@H](c2ccco2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H18F4N2O2.ClH/c18-16(19)17(20,21)25-13-5-3-12(4-6-13)15(14-2-1-11-24-14)23-9-7-22-8-10-23;/h1-6,11,15-16,22H,7-10H2;1H/t15-;/m0./s1 |
| InChIKey | LQEDGGOUAFIFEL-RSAXXLAASA-N |
| XLogP | 3.93 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|