C15H19ClF4N2O — CID 171171185
1-[(1R)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride (PubChem CID 171171185) has the molecular formula C15H19ClF4N2O and a molecular weight of 354.78 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171171185 |
| Molecular Formula | C15H19ClF4N2O |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-[(1R)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]prop-2-enyl]piperazine;hydrochloride |
| SMILES | C=C[C@H](c1ccc(OC(F)(F)C(F)F)cc1)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H18F4N2O.ClH/c1-2-13(21-9-7-20-8-10-21)11-3-5-12(6-4-11)22-15(18,19)14(16)17;/h2-6,13-14,20H,1,7-10H2;1H/t13-;/m1./s1 |
| InChIKey | KQMKBDLQPIDSKA-BTQNPOSSSA-N |
| XLogP | 3.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|