C16H20ClFN2S — CID 171175913
1-[(S)-(4-fluoro-3-methylphenyl)-thiophen-3-ylmethyl]piperazine;hydrochloride (PubChem CID 171175913) has the molecular formula C16H20ClFN2S and a molecular weight of 326.87 g/mol. Its IUPAC name is 1-[(S)-(4-fluoro-3-methylphenyl)-thiophen-3-ylmethyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-(4-fluoro-3-methylphenyl)-thiophen-3-ylmethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171175913 |
| Molecular Formula | C16H20ClFN2S |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-[(S)-(4-fluoro-3-methylphenyl)-thiophen-3-ylmethyl]piperazine;hydrochloride |
| SMILES | Cc1cc([C@@H](c2ccsc2)N2CCNCC2)ccc1F.Cl |
| InChI | InChI=1S/C16H19FN2S.ClH/c1-12-10-13(2-3-15(12)17)16(14-4-9-20-11-14)19-7-5-18-6-8-19;/h2-4,9-11,16,18H,5-8H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | WOBRXZCSINILAB-NTISSMGPSA-N |
| XLogP | 3.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |