C22H24N2OS — CID 3848563
1-[(3-phenoxyphenyl)-thiophen-3-ylmethyl]-1,4-diazepane (PubChem CID 3848563) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-[(3-phenoxyphenyl)-thiophen-3-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(3-phenoxyphenyl)-thiophen-3-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3848563 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[(3-phenoxyphenyl)-thiophen-3-ylmethyl]-1,4-diazepane |
| SMILES | c1ccc(Oc2cccc(C(c3ccsc3)N3CCCNCC3)c2)cc1 |
| InChI | InChI=1S/C22H24N2OS/c1-2-7-20(8-3-1)25-21-9-4-6-18(16-21)22(19-10-15-26-17-19)24-13-5-11-23-12-14-24/h1-4,6-10,15-17,22-23H,5,11-14H2 |
| InChIKey | SMIXKPUSSNYKHY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |