C19H19BrCl2F6N2O2 — CID 171301901
4-bromo-2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-6-(trifluoromethyl)phenol;dihydrochloride (PubChem CID 171301901) has the molecular formula C19H19BrCl2F6N2O2 and a molecular weight of 572.17 g/mol. Its IUPAC name is 4-bromo-2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-6-(trifluoromethyl)phenol;dihydrochloride.
| Compound Name | 4-bromo-2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-6-(trifluoromethyl)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171301901 |
| Molecular Formula | C19H19BrCl2F6N2O2 |
| Molecular Weight | 572.17 g/mol |
| Exact Mass | 569.99 |
| IUPAC Name | 4-bromo-2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-6-(trifluoromethyl)phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C19H17BrF6N2O2.2ClH/c20-12-9-14(17(29)15(10-12)18(21,22)23)16(28-7-5-27-6-8-28)11-1-3-13(4-2-11)30-19(24,25)26;;/h1-4,9-10,16,27,29H,5-8H2;2*1H/t16-;;/m1../s1 |
| InChIKey | BGTCBPADCDCSAS-GGMCWBHBSA-N |
| XLogP | 5.91 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.17 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|