C14H18BrCl2N3S — CID 171289046
1-[(S)-(6-bromo-2-pyridinyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171289046) has the molecular formula C14H18BrCl2N3S and a molecular weight of 411.20 g/mol. Its IUPAC name is 1-[(S)-(6-bromo-2-pyridinyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(6-bromo-2-pyridinyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171289046 |
| Molecular Formula | C14H18BrCl2N3S |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 1-[(S)-(6-bromo-2-pyridinyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Brc1cccc([C@@H](c2cccs2)N2CCNCC2)n1.Cl.Cl |
| InChI | InChI=1S/C14H16BrN3S.2ClH/c15-13-5-1-3-11(17-13)14(12-4-2-10-19-12)18-8-6-16-7-9-18;;/h1-5,10,14,16H,6-9H2;2*1H/t14-;;/m0../s1 |
| InChIKey | QYSUBTFRWHACRK-UTLKBRERSA-N |
| XLogP | 3.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|