C16H16F4N2S — CID 171179028
1-[(R)-[4-fluoro-3-(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine (PubChem CID 171179028) has the molecular formula C16H16F4N2S and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-[(R)-[4-fluoro-3-(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(R)-[4-fluoro-3-(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171179028 |
| Molecular Formula | C16H16F4N2S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[(R)-[4-fluoro-3-(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine |
| SMILES | Fc1ccc([C@H](c2cccs2)N2CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H16F4N2S/c17-13-4-3-11(10-12(13)16(18,19)20)15(14-2-1-9-23-14)22-7-5-21-6-8-22/h1-4,9-10,15,21H,5-8H2/t15-/m1/s1 |
| InChIKey | DOHFUSYSBHJVPJ-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |