C16H24Cl3F3N2 — CID 171305667
1-[(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171305667) has the molecular formula C16H24Cl3F3N2 and a molecular weight of 407.74 g/mol. Its IUPAC name is 1-[(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305667 |
| Molecular Formula | C16H24Cl3F3N2 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1cc(Cl)cc(C(F)(F)F)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H22ClF3N2.2ClH/c1-3-11(2)15(22-6-4-21-5-7-22)12-8-13(16(18,19)20)10-14(17)9-12;;/h8-11,15,21H,3-7H2,1-2H3;2*1H/t11?,15-;;/m0../s1 |
| InChIKey | XSHICLTVPSXIIQ-QEDFBYNOSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |