C17H25BrClF3N2 — CID 171170523
1-[(1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride (PubChem CID 171170523) has the molecular formula C17H25BrClF3N2 and a molecular weight of 429.75 g/mol. Its IUPAC name is 1-[(1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170523 |
| Molecular Formula | C17H25BrClF3N2 |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 1-[(1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine;hydrochloride |
| SMILES | CCCC(C)[C@H](c1cc(Br)cc(C(F)(F)F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H24BrF3N2.ClH/c1-3-4-12(2)16(23-7-5-22-6-8-23)13-9-14(17(19,20)21)11-15(18)10-13;/h9-12,16,22H,3-8H2,1-2H3;1H/t12?,16-;/m1./s1 |
| InChIKey | IBASXLMYLBCYCQ-LWPABBACSA-N |
| XLogP | 5.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |