C18H27F3N2O — CID 171171154
1-[(1R)-1-[3-methoxy-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine (PubChem CID 171171154) has the molecular formula C18H27F3N2O and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(1R)-1-[3-methoxy-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-[3-methoxy-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171171154 |
| Molecular Formula | C18H27F3N2O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(1R)-1-[3-methoxy-5-(trifluoromethyl)phenyl]-2-methylpentyl]piperazine |
| SMILES | CCCC(C)[C@H](c1cc(OC)cc(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C18H27F3N2O/c1-4-5-13(2)17(23-8-6-22-7-9-23)14-10-15(18(19,20)21)12-16(11-14)24-3/h10-13,17,22H,4-9H2,1-3H3/t13?,17-/m1/s1 |
| InChIKey | LNPKIILVVNQZTQ-LRHAYUFXSA-N |
| XLogP | 4.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |