C14H19F3N2O — CID 171165775
1-[(1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]ethyl]piperazine (PubChem CID 171165775) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[(1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]ethyl]piperazine.
| Compound Name | 1-[(1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 171165775 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[(1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]ethyl]piperazine |
| SMILES | COc1cc([C@H](C)N2CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O/c1-10(19-5-3-18-4-6-19)11-7-12(14(15,16)17)9-13(8-11)20-2/h7-10,18H,3-6H2,1-2H3/t10-/m0/s1 |
| InChIKey | CAUIJTFWZSNYKL-JTQLQIEISA-N |
| XLogP | 2.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |