C15H18F6N2O — CID 171167327
1-[(1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethyl]piperazine (PubChem CID 171167327) has the molecular formula C15H18F6N2O and a molecular weight of 356.31 g/mol. Its IUPAC name is 1-[(1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 171167327 |
| Molecular Formula | C15H18F6N2O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]ethyl]piperazine |
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1[C@H](C)N1CCNCC1 |
| InChI | InChI=1S/C15H18F6N2O/c1-9(23-5-3-22-4-6-23)13-11(15(19,20)21)7-10(14(16,17)18)8-12(13)24-2/h7-9,22H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | DMYUEHZEBDQPTI-VIFPVBQESA-N |
| XLogP | 3.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |