C15H22ClF3N2O — CID 171173694
(4R)-4-piperazin-1-yl-4-[2-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride (PubChem CID 171173694) has the molecular formula C15H22ClF3N2O and a molecular weight of 338.80 g/mol. Its IUPAC name is (4R)-4-piperazin-1-yl-4-[2-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-piperazin-1-yl-4-[2-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171173694 |
| Molecular Formula | C15H22ClF3N2O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (4R)-4-piperazin-1-yl-4-[2-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
| SMILES | Cl.OCCC[C@H](c1ccccc1C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C15H21F3N2O.ClH/c16-15(17,18)13-5-2-1-4-12(13)14(6-3-11-21)20-9-7-19-8-10-20;/h1-2,4-5,14,19,21H,3,6-11H2;1H/t14-;/m1./s1 |
| InChIKey | RMPVERRVDMDDIA-PFEQFJNWSA-N |
| XLogP | 2.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |