C17H26ClF3N2S — CID 171167042
1-[(1S)-2-methyl-1-[2-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine;hydrochloride (PubChem CID 171167042) has the molecular formula C17H26ClF3N2S and a molecular weight of 382.92 g/mol. Its IUPAC name is 1-[(1S)-2-methyl-1-[2-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-2-methyl-1-[2-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167042 |
| Molecular Formula | C17H26ClF3N2S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[(1S)-2-methyl-1-[2-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine;hydrochloride |
| SMILES | CCCC(C)[C@@H](c1ccccc1SC(F)(F)F)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H25F3N2S.ClH/c1-3-6-13(2)16(22-11-9-21-10-12-22)14-7-4-5-8-15(14)23-17(18,19)20;/h4-5,7-8,13,16,21H,3,6,9-12H2,1-2H3;1H/t13?,16-;/m0./s1 |
| InChIKey | QQIDDZACHJFPQI-GPPWNDLUSA-N |
| XLogP | 5.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |