C13H17ClF3N3O3 — CID 171190084
(3S)-2,2-difluoro-3-(5-fluoro-2-nitrophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride (PubChem CID 171190084) has the molecular formula C13H17ClF3N3O3 and a molecular weight of 355.74 g/mol. Its IUPAC name is (3S)-2,2-difluoro-3-(5-fluoro-2-nitrophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride.
| Compound Name | (3S)-2,2-difluoro-3-(5-fluoro-2-nitrophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171190084 |
| Molecular Formula | C13H17ClF3N3O3 |
| Molecular Weight | 355.74 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (3S)-2,2-difluoro-3-(5-fluoro-2-nitrophenyl)-3-piperazin-1-ylpropan-1-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(F)cc1[C@H](N1CCNCC1)C(F)(F)CO |
| InChI | InChI=1S/C13H16F3N3O3.ClH/c14-9-1-2-11(19(21)22)10(7-9)12(13(15,16)8-20)18-5-3-17-4-6-18;/h1-2,7,12,17,20H,3-6,8H2;1H/t12-;/m0./s1 |
| InChIKey | IICLCQIEXZOEOL-YDALLXLXSA-N |
| XLogP | 1.73 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|