C13H18ClF2N3O4 — CID 171189799
2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-nitrophenol;hydrochloride (PubChem CID 171189799) has the molecular formula C13H18ClF2N3O4 and a molecular weight of 353.75 g/mol. Its IUPAC name is 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-nitrophenol;hydrochloride.
| Compound Name | 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171189799 |
| Molecular Formula | C13H18ClF2N3O4 |
| Molecular Weight | 353.75 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-nitrophenol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(O)c([C@H](N2CCNCC2)C(F)(F)CO)c1 |
| InChI | InChI=1S/C13H17F2N3O4.ClH/c14-13(15,8-19)12(17-5-3-16-4-6-17)10-7-9(18(21)22)1-2-11(10)20;/h1-2,7,12,16,19-20H,3-6,8H2;1H/t12-;/m0./s1 |
| InChIKey | RISIIAPNMMXLEL-YDALLXLXSA-N |
| XLogP | 1.30 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.75 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|