C17H26F2N2O3 — CID 171177793
2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-[(2-methylpropan-2-yl)oxy]phenol (PubChem CID 171177793) has the molecular formula C17H26F2N2O3 and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-[(2-methylpropan-2-yl)oxy]phenol.
| Compound Name | 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-[(2-methylpropan-2-yl)oxy]phenol |
|---|---|
| PubChem CID | 171177793 |
| Molecular Formula | C17H26F2N2O3 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[(1S)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4-[(2-methylpropan-2-yl)oxy]phenol |
| SMILES | CC(C)(C)Oc1ccc(O)c([C@H](N2CCNCC2)C(F)(F)CO)c1 |
| InChI | InChI=1S/C17H26F2N2O3/c1-16(2,3)24-12-4-5-14(23)13(10-12)15(17(18,19)11-22)21-8-6-20-7-9-21/h4-5,10,15,20,22-23H,6-9,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | RTOJQDGLUGRXKS-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|