C17H25F3N2O2 — CID 171167421
4-[(2-methylpropan-2-yl)oxy]-2-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol (PubChem CID 171167421) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-2-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-2-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol |
|---|---|
| PubChem CID | 171167421 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-2-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]phenol |
| SMILES | CC(C)(C)Oc1ccc(O)c([C@H](CC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H25F3N2O2/c1-16(2,3)24-12-4-5-15(23)13(10-12)14(11-17(18,19)20)22-8-6-21-7-9-22/h4-5,10,14,21,23H,6-9,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | ZJAIYRSHTSUFBK-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|