C15H22F2N2O — CID 171181466
(3R)-3-(2,5-dimethylphenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol (PubChem CID 171181466) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is (3R)-3-(2,5-dimethylphenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol.
| Compound Name | (3R)-3-(2,5-dimethylphenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 171181466 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (3R)-3-(2,5-dimethylphenyl)-2,2-difluoro-3-piperazin-1-ylpropan-1-ol |
| SMILES | Cc1ccc(C)c([C@@H](N2CCNCC2)C(F)(F)CO)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-11-3-4-12(2)13(9-11)14(15(16,17)10-20)19-7-5-18-6-8-19/h3-4,9,14,18,20H,5-8,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | LVMCMKFWDMKBME-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |