C14H23ClN2O — CID 171183677
(2R)-2-(2,5-dimethylphenyl)-2-piperazin-1-ylethanol;hydrochloride (PubChem CID 171183677) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is (2R)-2-(2,5-dimethylphenyl)-2-piperazin-1-ylethanol;hydrochloride.
| Compound Name | (2R)-2-(2,5-dimethylphenyl)-2-piperazin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 171183677 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2R)-2-(2,5-dimethylphenyl)-2-piperazin-1-ylethanol;hydrochloride |
| SMILES | Cc1ccc(C)c([C@H](CO)N2CCNCC2)c1.Cl |
| InChI | InChI=1S/C14H22N2O.ClH/c1-11-3-4-12(2)13(9-11)14(10-17)16-7-5-15-6-8-16;/h3-4,9,14-15,17H,5-8,10H2,1-2H3;1H/t14-;/m0./s1 |
| InChIKey | BYHKFWXVHVPJOZ-UQKRIMTDSA-N |
| XLogP | 1.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |