C13H20Cl2N2O2 — CID 171183229
4-chloro-2-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]-6-methylphenol;hydrochloride (PubChem CID 171183229) has the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 4-chloro-2-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]-6-methylphenol;hydrochloride.
| Compound Name | 4-chloro-2-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171183229 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-chloro-2-[(1S)-2-hydroxy-1-piperazin-1-ylethyl]-6-methylphenol;hydrochloride |
| SMILES | Cc1cc(Cl)cc([C@@H](CO)N2CCNCC2)c1O.Cl |
| InChI | InChI=1S/C13H19ClN2O2.ClH/c1-9-6-10(14)7-11(13(9)18)12(8-17)16-4-2-15-3-5-16;/h6-7,12,15,17-18H,2-5,8H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | PLPNEVRZPNNVJV-UTONKHPSSA-N |
| XLogP | 1.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|