C13H16ClF3N2O — CID 171177895
4-chloro-2-methyl-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol (PubChem CID 171177895) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol.
| Compound Name | 4-chloro-2-methyl-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171177895 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-chloro-2-methyl-6-[(1S)-2,2,2-trifluoro-1-piperazin-1-ylethyl]phenol |
| SMILES | Cc1cc(Cl)cc([C@H](N2CCNCC2)C(F)(F)F)c1O |
| InChI | InChI=1S/C13H16ClF3N2O/c1-8-6-9(14)7-10(11(8)20)12(13(15,16)17)19-4-2-18-3-5-19/h6-7,12,18,20H,2-5H2,1H3/t12-/m0/s1 |
| InChIKey | RQBDDMDHJLZOLY-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|