C13H20Cl2FN3O3 — CID 171288630
1-[(1S)-2-fluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171288630) has the molecular formula C13H20Cl2FN3O3 and a molecular weight of 356.23 g/mol. Its IUPAC name is 1-[(1S)-2-fluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2-fluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288630 |
| Molecular Formula | C13H20Cl2FN3O3 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-[(1S)-2-fluoro-1-(4-methoxy-3-nitrophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@@H](CF)N2CCNCC2)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C13H18FN3O3.2ClH/c1-20-13-3-2-10(8-11(13)17(18)19)12(9-14)16-6-4-15-5-7-16;;/h2-3,8,12,15H,4-7,9H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | IVRRFQYLEKHZCO-CURYUGHLSA-N |
| XLogP | 2.36 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|