C12H16Cl2F3N3O2 — CID 171291426
1-[(1S)-2,2-difluoro-1-(4-fluoro-3-nitrophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171291426) has the molecular formula C12H16Cl2F3N3O2 and a molecular weight of 362.18 g/mol. Its IUPAC name is 1-[(1S)-2,2-difluoro-1-(4-fluoro-3-nitrophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2,2-difluoro-1-(4-fluoro-3-nitrophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171291426 |
| Molecular Formula | C12H16Cl2F3N3O2 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 1-[(1S)-2,2-difluoro-1-(4-fluoro-3-nitrophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cc([C@@H](C(F)F)N2CCNCC2)ccc1F |
| InChI | InChI=1S/C12H14F3N3O2.2ClH/c13-9-2-1-8(7-10(9)18(19)20)11(12(14)15)17-5-3-16-4-6-17;;/h1-2,7,11-12,16H,3-6H2;2*1H/t11-;;/m0../s1 |
| InChIKey | WYVTZCNGYNUTMY-IDMXKUIJSA-N |
| XLogP | 2.79 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|