C12H17Cl2F2N3O2 — CID 171285033
1-[(1S)-2,2-difluoro-1-(3-nitrophenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171285033) has the molecular formula C12H17Cl2F2N3O2 and a molecular weight of 344.19 g/mol. Its IUPAC name is 1-[(1S)-2,2-difluoro-1-(3-nitrophenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2,2-difluoro-1-(3-nitrophenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171285033 |
| Molecular Formula | C12H17Cl2F2N3O2 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-[(1S)-2,2-difluoro-1-(3-nitrophenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1cccc([C@@H](C(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C12H15F2N3O2.2ClH/c13-12(14)11(16-6-4-15-5-7-16)9-2-1-3-10(8-9)17(18)19;;/h1-3,8,11-12,15H,4-7H2;2*1H/t11-;;/m0../s1 |
| InChIKey | VDNGETRZFDCNAE-IDMXKUIJSA-N |
| XLogP | 2.65 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|