C14H17BrF3N3O3 — CID 171303070
2-bromo-4-nitro-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171303070) has the molecular formula C14H17BrF3N3O3 and a molecular weight of 412.21 g/mol. Its IUPAC name is 2-bromo-4-nitro-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 2-bromo-4-nitro-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171303070 |
| Molecular Formula | C14H17BrF3N3O3 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 2-bromo-4-nitro-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c([C@H](CCC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H17BrF3N3O3/c15-11-8-9(21(23)24)7-10(13(11)22)12(1-2-14(16,17)18)20-5-3-19-4-6-20/h7-8,12,19,22H,1-6H2/t12-/m0/s1 |
| InChIKey | KEQYZMMRYXGKMC-LBPRGKRZSA-N |
| XLogP | 3.35 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|