C16H23F3N2 — CID 171164996
1-[(1S)-1-(3,4,5-trifluorophenyl)hexyl]piperazine (PubChem CID 171164996) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4,5-trifluorophenyl)hexyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,4,5-trifluorophenyl)hexyl]piperazine |
|---|---|
| PubChem CID | 171164996 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[(1S)-1-(3,4,5-trifluorophenyl)hexyl]piperazine |
| SMILES | CCCCC[C@@H](c1cc(F)c(F)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C16H23F3N2/c1-2-3-4-5-15(21-8-6-20-7-9-21)12-10-13(17)16(19)14(18)11-12/h10-11,15,20H,2-9H2,1H3/t15-/m0/s1 |
| InChIKey | YPLGAESAIVRINX-HNNXBMFYSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|