C15H20ClF3N2O — CID 171174645
(4S)-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol (PubChem CID 171174645) has the molecular formula C15H20ClF3N2O and a molecular weight of 336.79 g/mol. Its IUPAC name is (4S)-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol.
| Compound Name | (4S)-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol |
|---|---|
| PubChem CID | 171174645 |
| Molecular Formula | C15H20ClF3N2O |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (4S)-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-piperazin-1-ylbutan-1-ol |
| SMILES | OCCC[C@@H](c1cc(C(F)(F)F)ccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C15H20ClF3N2O/c16-13-4-3-11(15(17,18)19)10-12(13)14(2-1-9-22)21-7-5-20-6-8-21/h3-4,10,14,20,22H,1-2,5-9H2/t14-/m0/s1 |
| InChIKey | NEHMFBKEKQWXJI-AWEZNQCLSA-N |
| XLogP | 3.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |