C21H23ClF2N2 — CID 171177676
1-[(1R)-3,3-difluoro-1-phenanthren-9-ylpropyl]piperazine;hydrochloride (PubChem CID 171177676) has the molecular formula C21H23ClF2N2 and a molecular weight of 376.88 g/mol. Its IUPAC name is 1-[(1R)-3,3-difluoro-1-phenanthren-9-ylpropyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-3,3-difluoro-1-phenanthren-9-ylpropyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171177676 |
| Molecular Formula | C21H23ClF2N2 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[(1R)-3,3-difluoro-1-phenanthren-9-ylpropyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)C[C@H](c1cc2ccccc2c2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C21H22F2N2.ClH/c22-21(23)14-20(25-11-9-24-10-12-25)19-13-15-5-1-2-6-16(15)17-7-3-4-8-18(17)19;/h1-8,13,20-21,24H,9-12,14H2;1H/t20-;/m1./s1 |
| InChIKey | VRVUXYMOADOYKE-VEIFNGETSA-N |
| XLogP | 5.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|