C19H26N2O — CID 171281801
1-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-2-ol (PubChem CID 171281801) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-2-ol.
| Compound Name | 1-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 171281801 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]naphthalen-2-ol |
| SMILES | CC(C)(C)[C@@H](c1c(O)ccc2ccccc12)N1CCNCC1 |
| InChI | InChI=1S/C19H26N2O/c1-19(2,3)18(21-12-10-20-11-13-21)17-15-7-5-4-6-14(15)8-9-16(17)22/h4-9,18,20,22H,10-13H2,1-3H3/t18-/m1/s1 |
| InChIKey | GTNGJECLEKMYAD-GOSISDBHSA-N |
| XLogP | 3.54 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|