C19H26Cl2N2O — CID 171294417
1-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]naphthalen-2-ol;dihydrochloride (PubChem CID 171294417) has the molecular formula C19H26Cl2N2O and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]naphthalen-2-ol;dihydrochloride.
| Compound Name | 1-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]naphthalen-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 171294417 |
| Molecular Formula | C19H26Cl2N2O |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[(1R)-2-cyclopropyl-1-piperazin-1-ylethyl]naphthalen-2-ol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc2ccccc2c1[C@@H](CC1CC1)N1CCNCC1 |
| InChI | InChI=1S/C19H24N2O.2ClH/c22-18-8-7-15-3-1-2-4-16(15)19(18)17(13-14-5-6-14)21-11-9-20-10-12-21;;/h1-4,7-8,14,17,20,22H,5-6,9-13H2;2*1H/t17-;;/m1../s1 |
| InChIKey | UJEOKBZTVIYGFX-ZEECNFPPSA-N |
| XLogP | 4.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|