C19H28Cl2N2O — CID 171308012
4-[(1R)-1-piperazin-1-ylpentyl]naphthalen-1-ol;dihydrochloride (PubChem CID 171308012) has the molecular formula C19H28Cl2N2O and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-[(1R)-1-piperazin-1-ylpentyl]naphthalen-1-ol;dihydrochloride.
| Compound Name | 4-[(1R)-1-piperazin-1-ylpentyl]naphthalen-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 171308012 |
| Molecular Formula | C19H28Cl2N2O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[(1R)-1-piperazin-1-ylpentyl]naphthalen-1-ol;dihydrochloride |
| SMILES | CCCC[C@H](c1ccc(O)c2ccccc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H26N2O.2ClH/c1-2-3-8-18(21-13-11-20-12-14-21)16-9-10-19(22)17-7-5-4-6-15(16)17;;/h4-7,9-10,18,20,22H,2-3,8,11-14H2,1H3;2*1H/t18-;;/m1../s1 |
| InChIKey | PZVPDLFILHPEME-JPKZNVRTSA-N |
| XLogP | 4.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |