C12H17FN2O3 — CID 171181715
4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]benzene-1,2,3-triol (PubChem CID 171181715) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is 4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]benzene-1,2,3-triol.
| Compound Name | 4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 171181715 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-[(1S)-2-fluoro-1-piperazin-1-ylethyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc([C@@H](CF)N2CCNCC2)c(O)c1O |
| InChI | InChI=1S/C12H17FN2O3/c13-7-9(15-5-3-14-4-6-15)8-1-2-10(16)12(18)11(8)17/h1-2,9,14,16-18H,3-7H2/t9-/m1/s1 |
| InChIKey | REGWHZJNDOAVRR-SECBINFHSA-N |
| XLogP | 0.72 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|