C14H18Cl2FN3O — CID 171298799
3-fluoro-4-hydroxy-5-[(1S)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride (PubChem CID 171298799) has the molecular formula C14H18Cl2FN3O and a molecular weight of 334.22 g/mol. Its IUPAC name is 3-fluoro-4-hydroxy-5-[(1S)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride.
| Compound Name | 3-fluoro-4-hydroxy-5-[(1S)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171298799 |
| Molecular Formula | C14H18Cl2FN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-fluoro-4-hydroxy-5-[(1S)-1-piperazin-1-ylprop-2-enyl]benzonitrile;dihydrochloride |
| SMILES | C=C[C@@H](c1cc(C#N)cc(F)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H16FN3O.2ClH/c1-2-13(18-5-3-17-4-6-18)11-7-10(9-16)8-12(15)14(11)19;;/h2,7-8,13,17,19H,1,3-6H2;2*1H/t13-;;/m0../s1 |
| InChIKey | NFOUPOLWQIDRRR-GXKRWWSZSA-N |
| XLogP | 2.38 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|