C15H21Cl3N2O — CID 171190927
(3S)-2,2-dimethyl-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol (PubChem CID 171190927) has the molecular formula C15H21Cl3N2O and a molecular weight of 351.71 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol.
| Compound Name | (3S)-2,2-dimethyl-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 171190927 |
| Molecular Formula | C15H21Cl3N2O |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (3S)-2,2-dimethyl-3-piperazin-1-yl-3-(2,3,5-trichlorophenyl)propan-1-ol |
| SMILES | CC(C)(CO)[C@@H](c1cc(Cl)cc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C15H21Cl3N2O/c1-15(2,9-21)14(20-5-3-19-4-6-20)11-7-10(16)8-12(17)13(11)18/h7-8,14,19,21H,3-6,9H2,1-2H3/t14-/m1/s1 |
| InChIKey | TWUVCZMDLVCQSU-CQSZACIVSA-N |
| XLogP | 3.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|