C15H23ClFIN2O — CID 171181489
(3S)-3-(2-fluoro-5-iodophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride (PubChem CID 171181489) has the molecular formula C15H23ClFIN2O and a molecular weight of 428.72 g/mol. Its IUPAC name is (3S)-3-(2-fluoro-5-iodophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride.
| Compound Name | (3S)-3-(2-fluoro-5-iodophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171181489 |
| Molecular Formula | C15H23ClFIN2O |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | (3S)-3-(2-fluoro-5-iodophenyl)-2,2-dimethyl-3-piperazin-1-ylpropan-1-ol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](c1cc(I)ccc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H22FIN2O.ClH/c1-15(2,10-20)14(19-7-5-18-6-8-19)12-9-11(17)3-4-13(12)16;/h3-4,9,14,18,20H,5-8,10H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | SBPUQDDXGKYSAS-PFEQFJNWSA-N |
| XLogP | 2.82 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|