C14H20Cl2N2 — CID 114079692
1-[1-(2,3-dichlorophenyl)ethyl]-2,2-dimethylpiperazine (PubChem CID 114079692) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[1-(2,3-dichlorophenyl)ethyl]-2,2-dimethylpiperazine.
| Compound Name | 1-[1-(2,3-dichlorophenyl)ethyl]-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 114079692 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[1-(2,3-dichlorophenyl)ethyl]-2,2-dimethylpiperazine |
| SMILES | CC(c1cccc(Cl)c1Cl)N1CCNCC1(C)C |
| InChI | InChI=1S/C14H20Cl2N2/c1-10(11-5-4-6-12(15)13(11)16)18-8-7-17-9-14(18,2)3/h4-6,10,17H,7-9H2,1-3H3 |
| InChIKey | FPHJHIAMKRPYGX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |