C15H22Cl2N2 — CID 171288417
1-[(1R)-1-(3,5-dichlorophenyl)-2,2-dimethylpropyl]piperazine (PubChem CID 171288417) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-[(1R)-1-(3,5-dichlorophenyl)-2,2-dimethylpropyl]piperazine.
| Compound Name | 1-[(1R)-1-(3,5-dichlorophenyl)-2,2-dimethylpropyl]piperazine |
|---|---|
| PubChem CID | 171288417 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[(1R)-1-(3,5-dichlorophenyl)-2,2-dimethylpropyl]piperazine |
| SMILES | CC(C)(C)[C@H](c1cc(Cl)cc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C15H22Cl2N2/c1-15(2,3)14(19-6-4-18-5-7-19)11-8-12(16)10-13(17)9-11/h8-10,14,18H,4-7H2,1-3H3/t14-/m0/s1 |
| InChIKey | OWEHQJCZKAXYRV-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |