C17H27Cl2N3O2 — CID 171299109
3-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-hydroxy-5-methoxybenzonitrile;dihydrochloride (PubChem CID 171299109) has the molecular formula C17H27Cl2N3O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is 3-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-hydroxy-5-methoxybenzonitrile;dihydrochloride.
| Compound Name | 3-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-hydroxy-5-methoxybenzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171299109 |
| Molecular Formula | C17H27Cl2N3O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-4-hydroxy-5-methoxybenzonitrile;dihydrochloride |
| SMILES | COc1cc(C#N)cc([C@@H](N2CCNCC2)C(C)(C)C)c1O.Cl.Cl |
| InChI | InChI=1S/C17H25N3O2.2ClH/c1-17(2,3)16(20-7-5-19-6-8-20)13-9-12(11-18)10-14(22-4)15(13)21;;/h9-10,16,19,21H,5-8H2,1-4H3;2*1H/t16-;;/m1../s1 |
| InChIKey | AUEQPMWKHAXFOL-GGMCWBHBSA-N |
| XLogP | 3.11 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|