C13H22Cl2N2O3 — CID 171297280
2-[(1R)-1-piperazin-1-ylpropyl]benzene-1,3,5-triol;dihydrochloride (PubChem CID 171297280) has the molecular formula C13H22Cl2N2O3 and a molecular weight of 325.24 g/mol. Its IUPAC name is 2-[(1R)-1-piperazin-1-ylpropyl]benzene-1,3,5-triol;dihydrochloride.
| Compound Name | 2-[(1R)-1-piperazin-1-ylpropyl]benzene-1,3,5-triol;dihydrochloride |
|---|---|
| PubChem CID | 171297280 |
| Molecular Formula | C13H22Cl2N2O3 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[(1R)-1-piperazin-1-ylpropyl]benzene-1,3,5-triol;dihydrochloride |
| SMILES | CC[C@H](c1c(O)cc(O)cc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H20N2O3.2ClH/c1-2-10(15-5-3-14-4-6-15)13-11(17)7-9(16)8-12(13)18;;/h7-8,10,14,16-18H,2-6H2,1H3;2*1H/t10-;;/m1../s1 |
| InChIKey | HXJVNOWERSERCP-YQFADDPSSA-N |
| XLogP | 2.00 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|