C15H26Cl2N2O3 — CID 171284687
2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]benzene-1,3,5-triol;dihydrochloride (PubChem CID 171284687) has the molecular formula C15H26Cl2N2O3 and a molecular weight of 353.29 g/mol. Its IUPAC name is 2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]benzene-1,3,5-triol;dihydrochloride.
| Compound Name | 2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]benzene-1,3,5-triol;dihydrochloride |
|---|---|
| PubChem CID | 171284687 |
| Molecular Formula | C15H26Cl2N2O3 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-[(1S)-3-methyl-1-piperazin-1-ylbutyl]benzene-1,3,5-triol;dihydrochloride |
| SMILES | CC(C)C[C@@H](c1c(O)cc(O)cc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H24N2O3.2ClH/c1-10(2)7-12(17-5-3-16-4-6-17)15-13(19)8-11(18)9-14(15)20;;/h8-10,12,16,18-20H,3-7H2,1-2H3;2*1H/t12-;;/m0../s1 |
| InChIKey | JSOUKNTYVWUVNE-LTCKWSDVSA-N |
| XLogP | 2.64 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|